C15H17BrO2 — CID 10267307
2-bromo-3-cyclohex-2-en-1-yloxy-1-ethenyl-4-methoxybenzene (PubChem CID 10267307) has the molecular formula C15H17BrO2 and a molecular weight of 309.20 g/mol. Its IUPAC name is 2-bromo-3-cyclohex-2-en-1-yloxy-1-ethenyl-4-methoxybenzene.
| Compound Name | 2-bromo-3-cyclohex-2-en-1-yloxy-1-ethenyl-4-methoxybenzene |
|---|---|
| PubChem CID | 10267307 |
| Molecular Formula | C15H17BrO2 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-bromo-3-cyclohex-2-en-1-yloxy-1-ethenyl-4-methoxybenzene |
| SMILES | C=Cc1ccc(OC)c(OC2C=CCCC2)c1Br |
| InChI | InChI=1S/C15H17BrO2/c1-3-11-9-10-13(17-2)15(14(11)16)18-12-7-5-4-6-8-12/h3,5,7,9-10,12H,1,4,6,8H2,2H3 |
| InChIKey | FQOKTKUILNEOOO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|