C14H17BrO2 — CID 176513489
2-bromo-3-(cyclobutylmethoxy)-1-ethenyl-4-methoxybenzene (PubChem CID 176513489) has the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. Its IUPAC name is 2-bromo-3-(cyclobutylmethoxy)-1-ethenyl-4-methoxybenzene.
| Compound Name | 2-bromo-3-(cyclobutylmethoxy)-1-ethenyl-4-methoxybenzene |
|---|---|
| PubChem CID | 176513489 |
| Molecular Formula | C14H17BrO2 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-bromo-3-(cyclobutylmethoxy)-1-ethenyl-4-methoxybenzene |
| SMILES | C=Cc1ccc(OC)c(OCC2CCC2)c1Br |
| InChI | InChI=1S/C14H17BrO2/c1-3-11-7-8-12(16-2)14(13(11)15)17-9-10-5-4-6-10/h3,7-8,10H,1,4-6,9H2,2H3 |
| InChIKey | WBBQGULRKMLNIY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |