C13H15BrO — CID 107284123
4-bromo-2-cyclohex-2-en-1-yloxy-1-methylbenzene (PubChem CID 107284123) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is 4-bromo-2-cyclohex-2-en-1-yloxy-1-methylbenzene.
| Compound Name | 4-bromo-2-cyclohex-2-en-1-yloxy-1-methylbenzene |
|---|---|
| PubChem CID | 107284123 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 4-bromo-2-cyclohex-2-en-1-yloxy-1-methylbenzene |
| SMILES | Cc1ccc(Br)cc1OC1C=CCCC1 |
| InChI | InChI=1S/C13H15BrO/c1-10-7-8-11(14)9-13(10)15-12-5-3-2-4-6-12/h3,5,7-9,12H,2,4,6H2,1H3 |
| InChIKey | RFGGCAATLOWKRY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|