C13H13ClO3 — CID 54206426
5-chloro-2-cyclohex-2-en-1-yloxybenzoic acid (PubChem CID 54206426) has the molecular formula C13H13ClO3 and a molecular weight of 252.70 g/mol. Its IUPAC name is 5-chloro-2-cyclohex-2-en-1-yloxybenzoic acid.
| Compound Name | 5-chloro-2-cyclohex-2-en-1-yloxybenzoic acid |
|---|---|
| PubChem CID | 54206426 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 5-chloro-2-cyclohex-2-en-1-yloxybenzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1OC1C=CCCC1 |
| InChI | InChI=1S/C13H13ClO3/c14-9-6-7-12(11(8-9)13(15)16)17-10-4-2-1-3-5-10/h2,4,6-8,10H,1,3,5H2,(H,15,16) |
| InChIKey | PSUIRMGRCPADMM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|