C12H12Cl2O3S — CID 114619989
5-chloro-2-cyclohex-2-en-1-yloxybenzenesulfonyl chloride (PubChem CID 114619989) has the molecular formula C12H12Cl2O3S and a molecular weight of 307.20 g/mol. Its IUPAC name is 5-chloro-2-cyclohex-2-en-1-yloxybenzenesulfonyl chloride.
| Compound Name | 5-chloro-2-cyclohex-2-en-1-yloxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 114619989 |
| Molecular Formula | C12H12Cl2O3S |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 5-chloro-2-cyclohex-2-en-1-yloxybenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(Cl)ccc1OC1C=CCCC1 |
| InChI | InChI=1S/C12H12Cl2O3S/c13-9-6-7-11(12(8-9)18(14,15)16)17-10-4-2-1-3-5-10/h2,4,6-8,10H,1,3,5H2 |
| InChIKey | PYBFVABGJDCWCC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|