About 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene
1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene (PubChem CID 175072898) has the molecular formula C12H6Br2I2
and a molecular weight of 563.80 g/mol. Its IUPAC name is 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene.
Molecular Properties
| Compound Name | 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene |
| PubChem CID | 175072898 |
| Molecular Formula | C12H6Br2I2 |
| Molecular Weight | 563.80 g/mol |
| Exact Mass | 561.69 |
| IUPAC Name | 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene |
| SMILES | Brc1ccc(-c2ccc(Br)c(I)c2I)cc1 |
| InChI | InChI=1S/C12H6Br2I2/c13-8-3-1-7(2-4-8)9-5-6-10(14)12(16)11(9)15/h1-6H |
| InChIKey | HBNPGAOPWZBDFM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene?
The IUPAC name of 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene (CID 175072898) is 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene.
What is the SMILES notation for 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene?
The canonical SMILES for 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene is Brc1ccc(-c2ccc(Br)c(I)c2I)cc1.
What is the InChIKey of 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene?
The InChIKey is HBNPGAOPWZBDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br2I2/c13-8-3-1-7(2-4-8)9-5-6-10(14)12(16)11(9)15/h1-6H.
What are the key properties of 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene?
1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene has a molecular weight of 563.80 g/mol, XLogP of 6.09, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(4-bromophenyl)-2,3-diiodobenzene is sourced from PubChem (CID 175072898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).