C15H15Br — CID 174839809
1-(4-bromophenyl)-2,3,4-trimethylbenzene (PubChem CID 174839809) has the molecular formula C15H15Br and a molecular weight of 275.19 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,3,4-trimethylbenzene.
| Compound Name | 1-(4-bromophenyl)-2,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 174839809 |
| Molecular Formula | C15H15Br |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-(4-bromophenyl)-2,3,4-trimethylbenzene |
| SMILES | Cc1ccc(-c2ccc(Br)cc2)c(C)c1C |
| InChI | InChI=1S/C15H15Br/c1-10-4-9-15(12(3)11(10)2)13-5-7-14(16)8-6-13/h4-9H,1-3H3 |
| InChIKey | NPJAGIXHSFWBSI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |