About 2-bromo-3-iodo-1,4-diphenylbenzene
2-bromo-3-iodo-1,4-diphenylbenzene (PubChem CID 167285519) has the molecular formula C18H12BrI
and a molecular weight of 435.10 g/mol. Its IUPAC name is 2-bromo-3-iodo-1,4-diphenylbenzene.
Molecular Properties
| Compound Name | 2-bromo-3-iodo-1,4-diphenylbenzene |
| PubChem CID | 167285519 |
| Molecular Formula | C18H12BrI |
| Molecular Weight | 435.10 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | 2-bromo-3-iodo-1,4-diphenylbenzene |
| SMILES | Brc1c(-c2ccccc2)ccc(-c2ccccc2)c1I |
| InChI | InChI=1S/C18H12BrI/c19-17-15(13-7-3-1-4-8-13)11-12-16(18(17)20)14-9-5-2-6-10-14/h1-12H |
| InChIKey | JWIRVWHYBFBRLZ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.10 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-iodo-1,4-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-iodo-1,4-diphenylbenzene?
The IUPAC name of 2-bromo-3-iodo-1,4-diphenylbenzene (CID 167285519) is 2-bromo-3-iodo-1,4-diphenylbenzene.
What is the SMILES notation for 2-bromo-3-iodo-1,4-diphenylbenzene?
The canonical SMILES for 2-bromo-3-iodo-1,4-diphenylbenzene is Brc1c(-c2ccccc2)ccc(-c2ccccc2)c1I.
What is the InChIKey of 2-bromo-3-iodo-1,4-diphenylbenzene?
The InChIKey is JWIRVWHYBFBRLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrI/c19-17-15(13-7-3-1-4-8-13)11-12-16(18(17)20)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 2-bromo-3-iodo-1,4-diphenylbenzene?
2-bromo-3-iodo-1,4-diphenylbenzene has a molecular weight of 435.10 g/mol, XLogP of 6.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-iodo-1,4-diphenylbenzene is sourced from PubChem (CID 167285519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).