C20H25I — CID 122537988
1,2-ditert-butyl-3-iodo-4-phenylbenzene (PubChem CID 122537988) has the molecular formula C20H25I and a molecular weight of 392.32 g/mol. Its IUPAC name is 1,2-ditert-butyl-3-iodo-4-phenylbenzene.
| Compound Name | 1,2-ditert-butyl-3-iodo-4-phenylbenzene |
|---|---|
| PubChem CID | 122537988 |
| Molecular Formula | C20H25I |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1,2-ditert-butyl-3-iodo-4-phenylbenzene |
| SMILES | CC(C)(C)c1ccc(-c2ccccc2)c(I)c1C(C)(C)C |
| InChI | InChI=1S/C20H25I/c1-19(2,3)16-13-12-15(14-10-8-7-9-11-14)18(21)17(16)20(4,5)6/h7-13H,1-6H3 |
| InChIKey | VFBVSFDVGXRWRA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|