C10H10BrN — CID 165370223
7-bromotricyclo[6.2.0.03,6]deca-1,3(6),7-trien-2-amine (PubChem CID 165370223) has the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. Its IUPAC name is 7-bromotricyclo[6.2.0.03,6]deca-1,3(6),7-trien-2-amine.
| Compound Name | 7-bromotricyclo[6.2.0.03,6]deca-1,3(6),7-trien-2-amine |
|---|---|
| PubChem CID | 165370223 |
| Molecular Formula | C10H10BrN |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 7-bromotricyclo[6.2.0.03,6]deca-1,3(6),7-trien-2-amine |
| SMILES | Nc1c2c(c(Br)c3c1CC3)CC2 |
| InChI | InChI=1S/C10H10BrN/c11-9-5-1-3-7(5)10(12)8-4-2-6(8)9/h1-4,12H2 |
| InChIKey | JMKLZFSWLLOICA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|