C10H16N4 — CID 163637874
5,6,7,8-tetrahydronaphthalene-1,2,3,4-tetramine (PubChem CID 163637874) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalene-1,2,3,4-tetramine.
| Compound Name | 5,6,7,8-tetrahydronaphthalene-1,2,3,4-tetramine |
|---|---|
| PubChem CID | 163637874 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalene-1,2,3,4-tetramine |
| SMILES | Nc1c(N)c(N)c2c(c1N)CCCC2 |
| InChI | InChI=1S/C10H16N4/c11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h1-4,11-14H2 |
| InChIKey | IBTATPDRAGBTPM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|