C14H15N — CID 155571395
8-ethynyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine (PubChem CID 155571395) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 8-ethynyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine.
| Compound Name | 8-ethynyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
|---|---|
| PubChem CID | 155571395 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 8-ethynyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
| SMILES | C#Cc1c2c(c(N)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C14H15N/c1-2-9-10-5-3-7-12(10)14(15)13-8-4-6-11(9)13/h1H,3-8,15H2 |
| InChIKey | DXSVTZPQKBSHAN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|