C24H24N4 — CID 102136429
2-amino-4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile (PubChem CID 102136429) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-amino-4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 102136429 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-amino-4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c(-c2cc3c4c(c2)CCCN4CCC3)c2c1CCCC2 |
| InChI | InChI=1S/C24H24N4/c25-13-20-18-7-1-2-8-19(18)22(21(14-26)23(20)27)17-11-15-5-3-9-28-10-4-6-16(12-17)24(15)28/h11-12H,1-10,27H2 |
| InChIKey | JLOIOKJDDUGISN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|