C56H43N5 — CID 135252761
7-[4-[3,5-bis(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (PubChem CID 135252761) has the molecular formula C56H43N5 and a molecular weight of 786.00 g/mol. Its IUPAC name is 7-[4-[3,5-bis(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
| Compound Name | 7-[4-[3,5-bis(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
|---|---|
| PubChem CID | 135252761 |
| Molecular Formula | C56H43N5 |
| Molecular Weight | 786.00 g/mol |
| Exact Mass | 785.35 |
| IUPAC Name | 7-[4-[3,5-bis(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cc(-c4ccc(-c5cc6c7c(c5)CCCN7CCC6)cc4)cc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C56H43N5/c1-5-15-40(16-6-1)50-36-51(41-17-7-2-8-18-41)58-55(57-50)48-33-47(39-27-25-38(26-28-39)46-31-44-23-13-29-61-30-14-24-45(32-46)54(44)61)34-49(35-48)56-59-52(42-19-9-3-10-20-42)37-53(60-56)43-21-11-4-12-22-43/h1-12,15-22,25-28,31-37H,13-14,23-24,29-30H2 |
| InChIKey | UNHOPSDNMWYNFS-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.00 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |