C17H13N3S — CID 132544332
6-amino-8-phenyl-3,4-dihydro-1H-isothiochromene-5,7-dicarbonitrile (PubChem CID 132544332) has the molecular formula C17H13N3S and a molecular weight of 291.38 g/mol. Its IUPAC name is 6-amino-8-phenyl-3,4-dihydro-1H-isothiochromene-5,7-dicarbonitrile.
| Compound Name | 6-amino-8-phenyl-3,4-dihydro-1H-isothiochromene-5,7-dicarbonitrile |
|---|---|
| PubChem CID | 132544332 |
| Molecular Formula | C17H13N3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 6-amino-8-phenyl-3,4-dihydro-1H-isothiochromene-5,7-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c(-c2ccccc2)c2c1CCSC2 |
| InChI | InChI=1S/C17H13N3S/c18-8-13-12-6-7-21-10-15(12)16(14(9-19)17(13)20)11-4-2-1-3-5-11/h1-5H,6-7,10,20H2 |
| InChIKey | WGVGHSDOEOVFPH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|