C22H14FN3 — CID 102084665
3-amino-1-(4-fluorophenyl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile (PubChem CID 102084665) has the molecular formula C22H14FN3 and a molecular weight of 339.37 g/mol. Its IUPAC name is 3-amino-1-(4-fluorophenyl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile.
| Compound Name | 3-amino-1-(4-fluorophenyl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 102084665 |
| Molecular Formula | C22H14FN3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-amino-1-(4-fluorophenyl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c2c(c1-c1ccc(F)cc1)CCc1ccccc1-2 |
| InChI | InChI=1S/C22H14FN3/c23-15-8-5-14(6-9-15)20-17-10-7-13-3-1-2-4-16(13)21(17)19(12-25)22(26)18(20)11-24/h1-6,8-9H,7,10,26H2 |
| InChIKey | MFRMHGPDRPVMRS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|