C20H12FN3 — CID 12601373
2-amino-4-(4-fluorophenyl)-6-phenylbenzene-1,3-dicarbonitrile (PubChem CID 12601373) has the molecular formula C20H12FN3 and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-amino-4-(4-fluorophenyl)-6-phenylbenzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-(4-fluorophenyl)-6-phenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 12601373 |
| Molecular Formula | C20H12FN3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-amino-4-(4-fluorophenyl)-6-phenylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccc(F)cc2)c(C#N)c1N |
| InChI | InChI=1S/C20H12FN3/c21-15-8-6-14(7-9-15)17-10-16(13-4-2-1-3-5-13)18(11-22)20(24)19(17)12-23/h1-10H,24H2 |
| InChIKey | BZWCQHXMRBZZJN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|