C24H13ClFN3O — CID 5161144
2-amino-4-(4-chlorophenyl)-6-[5-(2-fluorophenyl)furan-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 5161144) has the molecular formula C24H13ClFN3O and a molecular weight of 413.84 g/mol. Its IUPAC name is 2-amino-4-(4-chlorophenyl)-6-[5-(2-fluorophenyl)furan-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-(4-chlorophenyl)-6-[5-(2-fluorophenyl)furan-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 5161144 |
| Molecular Formula | C24H13ClFN3O |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-amino-4-(4-chlorophenyl)-6-[5-(2-fluorophenyl)furan-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)cc(-c2ccc(-c3ccccc3F)o2)c(C#N)c1N |
| InChI | InChI=1S/C24H13ClFN3O/c25-15-7-5-14(6-8-15)17-11-18(20(13-28)24(29)19(17)12-27)23-10-9-22(30-23)16-3-1-2-4-21(16)26/h1-11H,29H2 |
| InChIKey | PJVVKJJUZXQPLR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|