C20H14N2O — CID 101458211
2-amino-3-formyl-4,6-diphenylbenzonitrile (PubChem CID 101458211) has the molecular formula C20H14N2O and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-amino-3-formyl-4,6-diphenylbenzonitrile.
| Compound Name | 2-amino-3-formyl-4,6-diphenylbenzonitrile |
|---|---|
| PubChem CID | 101458211 |
| Molecular Formula | C20H14N2O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-amino-3-formyl-4,6-diphenylbenzonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccccc2)c(C=O)c1N |
| InChI | InChI=1S/C20H14N2O/c21-12-18-16(14-7-3-1-4-8-14)11-17(19(13-23)20(18)22)15-9-5-2-6-10-15/h1-11,13H,22H2 |
| InChIKey | ISTUWEDIQLYKQH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|