C21H14N4S — CID 131846030
5-amino-2,7-diphenyl-4-sulfanylidene-1H-quinazoline-6-carbonitrile (PubChem CID 131846030) has the molecular formula C21H14N4S and a molecular weight of 354.44 g/mol. Its IUPAC name is 5-amino-2,7-diphenyl-4-sulfanylidene-1H-quinazoline-6-carbonitrile.
| Compound Name | 5-amino-2,7-diphenyl-4-sulfanylidene-1H-quinazoline-6-carbonitrile |
|---|---|
| PubChem CID | 131846030 |
| Molecular Formula | C21H14N4S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-amino-2,7-diphenyl-4-sulfanylidene-1H-quinazoline-6-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc2[nH]c(-c3ccccc3)nc(=S)c2c1N |
| InChI | InChI=1S/C21H14N4S/c22-12-16-15(13-7-3-1-4-8-13)11-17-18(19(16)23)21(26)25-20(24-17)14-9-5-2-6-10-14/h1-11H,23H2,(H,24,25,26) |
| InChIKey | JKFCDPYXAPKCTB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|