C16H11BrN2S — CID 106478906
5-bromo-2,6-diphenyl-1H-pyrimidine-4-thione (PubChem CID 106478906) has the molecular formula C16H11BrN2S and a molecular weight of 343.25 g/mol. Its IUPAC name is 5-bromo-2,6-diphenyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2,6-diphenyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478906 |
| Molecular Formula | C16H11BrN2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 5-bromo-2,6-diphenyl-1H-pyrimidine-4-thione |
| SMILES | S=c1nc(-c2ccccc2)[nH]c(-c2ccccc2)c1Br |
| InChI | InChI=1S/C16H11BrN2S/c17-13-14(11-7-3-1-4-8-11)18-15(19-16(13)20)12-9-5-2-6-10-12/h1-10H,(H,18,19,20) |
| InChIKey | YGSVIXRNHYKFTO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|