C15H15BrN2OS — CID 106478970
5-bromo-2-(oxolan-3-ylmethyl)-6-phenyl-1H-pyrimidine-4-thione (PubChem CID 106478970) has the molecular formula C15H15BrN2OS and a molecular weight of 351.27 g/mol. Its IUPAC name is 5-bromo-2-(oxolan-3-ylmethyl)-6-phenyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(oxolan-3-ylmethyl)-6-phenyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478970 |
| Molecular Formula | C15H15BrN2OS |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 5-bromo-2-(oxolan-3-ylmethyl)-6-phenyl-1H-pyrimidine-4-thione |
| SMILES | S=c1nc(CC2CCOC2)[nH]c(-c2ccccc2)c1Br |
| InChI | InChI=1S/C15H15BrN2OS/c16-13-14(11-4-2-1-3-5-11)17-12(18-15(13)20)8-10-6-7-19-9-10/h1-5,10H,6-9H2,(H,17,18,20) |
| InChIKey | AEEBDQLBXDFKPG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|