C9H11F3N2O — CID 170722463
2-(oxolan-3-ylmethyl)-5-(trifluoromethyl)-1H-imidazole (PubChem CID 170722463) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)-5-(trifluoromethyl)-1H-imidazole.
| Compound Name | 2-(oxolan-3-ylmethyl)-5-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 170722463 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)-5-(trifluoromethyl)-1H-imidazole |
| SMILES | FC(F)(F)c1cnc(CC2CCOC2)[nH]1 |
| InChI | InChI=1S/C9H11F3N2O/c10-9(11,12)7-4-13-8(14-7)3-6-1-2-15-5-6/h4,6H,1-3,5H2,(H,13,14) |
| InChIKey | CATKZYNECPMIEO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |