C10H17F3N2OSi — CID 123459953
trimethyl-[2-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methoxy]ethyl]silane (PubChem CID 123459953) has the molecular formula C10H17F3N2OSi and a molecular weight of 266.34 g/mol. Its IUPAC name is trimethyl-[2-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 123459953 |
| Molecular Formula | C10H17F3N2OSi |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | trimethyl-[2-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCc1ncc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C10H17F3N2OSi/c1-17(2,3)5-4-16-7-9-14-6-8(15-9)10(11,12)13/h6H,4-5,7H2,1-3H3,(H,14,15) |
| InChIKey | HAFMACGIPOVSNB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|