C10H20N2O2Si — CID 70088633
[5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]methanol (PubChem CID 70088633) has the molecular formula C10H20N2O2Si and a molecular weight of 228.37 g/mol. Its IUPAC name is [5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]methanol.
| Compound Name | [5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]methanol |
|---|---|
| PubChem CID | 70088633 |
| Molecular Formula | C10H20N2O2Si |
| Molecular Weight | 228.37 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]methanol |
| SMILES | C[Si](C)(C)CCOCc1cnc(CO)[nH]1 |
| InChI | InChI=1S/C10H20N2O2Si/c1-15(2,3)5-4-14-8-9-6-11-10(7-13)12-9/h6,13H,4-5,7-8H2,1-3H3,(H,11,12) |
| InChIKey | NGVNXCKBNGZEHW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|