C15H22N2O3SSi — CID 154179835
trimethyl-[2-[[2-(6-sulfonylcyclohexa-2,4-dien-1-yl)-1H-imidazol-5-yl]methoxy]ethyl]silane (PubChem CID 154179835) has the molecular formula C15H22N2O3SSi and a molecular weight of 338.50 g/mol. Its IUPAC name is trimethyl-[2-[[2-(6-sulfonylcyclohexa-2,4-dien-1-yl)-1H-imidazol-5-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[2-(6-sulfonylcyclohexa-2,4-dien-1-yl)-1H-imidazol-5-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 154179835 |
| Molecular Formula | C15H22N2O3SSi |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | trimethyl-[2-[[2-(6-sulfonylcyclohexa-2,4-dien-1-yl)-1H-imidazol-5-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCc1cnc(C2C=CC=CC2=S(=O)=O)[nH]1 |
| InChI | InChI=1S/C15H22N2O3SSi/c1-22(2,3)9-8-20-11-12-10-16-15(17-12)13-6-4-5-7-14(13)21(18)19/h4-7,10,13H,8-9,11H2,1-3H3,(H,16,17) |
| InChIKey | GDOOZFZMLQIJQS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|