C21H25N5OSi — CID 123407707
trimethyl-[2-[[2-(4-pyrazolo[1,5-a]pyrimidin-3-ylphenyl)-1H-imidazol-5-yl]methoxy]ethyl]silane (PubChem CID 123407707) has the molecular formula C21H25N5OSi and a molecular weight of 391.55 g/mol. Its IUPAC name is trimethyl-[2-[[2-(4-pyrazolo[1,5-a]pyrimidin-3-ylphenyl)-1H-imidazol-5-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[2-(4-pyrazolo[1,5-a]pyrimidin-3-ylphenyl)-1H-imidazol-5-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 123407707 |
| Molecular Formula | C21H25N5OSi |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | trimethyl-[2-[[2-(4-pyrazolo[1,5-a]pyrimidin-3-ylphenyl)-1H-imidazol-5-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCc1cnc(-c2ccc(-c3cnn4cccnc34)cc2)[nH]1 |
| InChI | InChI=1S/C21H25N5OSi/c1-28(2,3)12-11-27-15-18-13-23-20(25-18)17-7-5-16(6-8-17)19-14-24-26-10-4-9-22-21(19)26/h4-10,13-14H,11-12,15H2,1-3H3,(H,23,25) |
| InChIKey | CAKNYVNCQBCUPS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|