About 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine
5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine (PubChem CID 167863871) has the molecular formula C13H9N5S
and a molecular weight of 267.32 g/mol. Its IUPAC name is 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine |
| PubChem CID | 167863871 |
| Molecular Formula | C13H9N5S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine |
| SMILES | Nc1nsc2ccc(-c3cnn4cccnc34)cc12 |
| InChI | InChI=1S/C13H9N5S/c14-12-9-6-8(2-3-11(9)19-17-12)10-7-16-18-5-1-4-15-13(10)18/h1-7H,(H2,14,17) |
| InChIKey | VNEBYWIUSUFDBX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine?
The IUPAC name of 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine (CID 167863871) is 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine.
What is the SMILES notation for 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine?
The canonical SMILES for 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine is Nc1nsc2ccc(-c3cnn4cccnc34)cc12.
What is the InChIKey of 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine?
The InChIKey is VNEBYWIUSUFDBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N5S/c14-12-9-6-8(2-3-11(9)19-17-12)10-7-16-18-5-1-4-15-13(10)18/h1-7H,(H2,14,17).
What are the key properties of 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine?
5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine has a molecular weight of 267.32 g/mol, XLogP of 2.59, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazolo[1,5-a]pyrimidin-3-yl-1,2-benzothiazol-3-amine is sourced from PubChem (CID 167863871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).