C13H21N3O2Si — CID 175749387
[3-(2-trimethylsilylethoxymethyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]methanol (PubChem CID 175749387) has the molecular formula C13H21N3O2Si and a molecular weight of 279.42 g/mol. Its IUPAC name is [3-(2-trimethylsilylethoxymethyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]methanol.
| Compound Name | [3-(2-trimethylsilylethoxymethyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 175749387 |
| Molecular Formula | C13H21N3O2Si |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | [3-(2-trimethylsilylethoxymethyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]methanol |
| SMILES | C[Si](C)(C)CCOCc1[nH]nc2ncc(CO)cc12 |
| InChI | InChI=1S/C13H21N3O2Si/c1-19(2,3)5-4-18-9-12-11-6-10(8-17)7-14-13(11)16-15-12/h6-7,17H,4-5,8-9H2,1-3H3,(H,14,15,16) |
| InChIKey | JALKHWOXHGGDQK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|