About (3-iodofuro[2,3-b]pyridin-5-yl)methanol
(3-iodofuro[2,3-b]pyridin-5-yl)methanol (PubChem CID 133061609) has the molecular formula C8H6INO2
and a molecular weight of 275.04 g/mol. Its IUPAC name is (3-iodofuro[2,3-b]pyridin-5-yl)methanol.
Molecular Properties
| Compound Name | (3-iodofuro[2,3-b]pyridin-5-yl)methanol |
| PubChem CID | 133061609 |
| Molecular Formula | C8H6INO2 |
| Molecular Weight | 275.04 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | (3-iodofuro[2,3-b]pyridin-5-yl)methanol |
| SMILES | OCc1cnc2occ(I)c2c1 |
| InChI | InChI=1S/C8H6INO2/c9-7-4-12-8-6(7)1-5(3-11)2-10-8/h1-2,4,11H,3H2 |
| InChIKey | CVNJORFGASWHHZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.04 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-iodofuro[2,3-b]pyridin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodofuro[2,3-b]pyridin-5-yl)methanol?
The IUPAC name of (3-iodofuro[2,3-b]pyridin-5-yl)methanol (CID 133061609) is (3-iodofuro[2,3-b]pyridin-5-yl)methanol.
What is the SMILES notation for (3-iodofuro[2,3-b]pyridin-5-yl)methanol?
The canonical SMILES for (3-iodofuro[2,3-b]pyridin-5-yl)methanol is OCc1cnc2occ(I)c2c1.
What is the InChIKey of (3-iodofuro[2,3-b]pyridin-5-yl)methanol?
The InChIKey is CVNJORFGASWHHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6INO2/c9-7-4-12-8-6(7)1-5(3-11)2-10-8/h1-2,4,11H,3H2.
What are the key properties of (3-iodofuro[2,3-b]pyridin-5-yl)methanol?
(3-iodofuro[2,3-b]pyridin-5-yl)methanol has a molecular weight of 275.04 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodofuro[2,3-b]pyridin-5-yl)methanol is sourced from PubChem (CID 133061609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).