C6H5I2NO — CID 133054700
(3,5-diiodo-2-pyridinyl)methanol (PubChem CID 133054700) has the molecular formula C6H5I2NO and a molecular weight of 360.92 g/mol. Its IUPAC name is (3,5-diiodo-2-pyridinyl)methanol.
| Compound Name | (3,5-diiodo-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 133054700 |
| Molecular Formula | C6H5I2NO |
| Molecular Weight | 360.92 g/mol |
| Exact Mass | 360.85 |
| IUPAC Name | (3,5-diiodo-2-pyridinyl)methanol |
| SMILES | OCc1ncc(I)cc1I |
| InChI | InChI=1S/C6H5I2NO/c7-4-1-5(8)6(3-10)9-2-4/h1-2,10H,3H2 |
| InChIKey | ZQGOZPRSAFOITC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.92 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|