C8H5F5INO — CID 130087709
[3-(difluoromethyl)-5-iodo-4-(trifluoromethyl)-2-pyridinyl]methanol (PubChem CID 130087709) has the molecular formula C8H5F5INO and a molecular weight of 353.03 g/mol. Its IUPAC name is [3-(difluoromethyl)-5-iodo-4-(trifluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [3-(difluoromethyl)-5-iodo-4-(trifluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130087709 |
| Molecular Formula | C8H5F5INO |
| Molecular Weight | 353.03 g/mol |
| Exact Mass | 352.93 |
| IUPAC Name | [3-(difluoromethyl)-5-iodo-4-(trifluoromethyl)-2-pyridinyl]methanol |
| SMILES | OCc1ncc(I)c(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C8H5F5INO/c9-7(10)5-4(2-16)15-1-3(14)6(5)8(11,12)13/h1,7,16H,2H2 |
| InChIKey | VVEWQTGWUQEPTN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.03 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|