C8H9F2IN2O — CID 118820101
[2-(aminomethyl)-4-(difluoromethyl)-5-iodo-3-pyridinyl]methanol (PubChem CID 118820101) has the molecular formula C8H9F2IN2O and a molecular weight of 314.07 g/mol. Its IUPAC name is [2-(aminomethyl)-4-(difluoromethyl)-5-iodo-3-pyridinyl]methanol.
| Compound Name | [2-(aminomethyl)-4-(difluoromethyl)-5-iodo-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 118820101 |
| Molecular Formula | C8H9F2IN2O |
| Molecular Weight | 314.07 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | [2-(aminomethyl)-4-(difluoromethyl)-5-iodo-3-pyridinyl]methanol |
| SMILES | NCc1ncc(I)c(C(F)F)c1CO |
| InChI | InChI=1S/C8H9F2IN2O/c9-8(10)7-4(3-14)6(1-12)13-2-5(7)11/h2,8,14H,1,3,12H2 |
| InChIKey | LEJBZBXVJAVNSW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.07 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|