C8H11F2N3O — CID 130107021
[5-amino-2-(aminomethyl)-3-(difluoromethyl)-4-pyridinyl]methanol (PubChem CID 130107021) has the molecular formula C8H11F2N3O and a molecular weight of 203.19 g/mol. Its IUPAC name is [5-amino-2-(aminomethyl)-3-(difluoromethyl)-4-pyridinyl]methanol.
| Compound Name | [5-amino-2-(aminomethyl)-3-(difluoromethyl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 130107021 |
| Molecular Formula | C8H11F2N3O |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | [5-amino-2-(aminomethyl)-3-(difluoromethyl)-4-pyridinyl]methanol |
| SMILES | NCc1ncc(N)c(CO)c1C(F)F |
| InChI | InChI=1S/C8H11F2N3O/c9-8(10)7-4(3-14)5(12)2-13-6(7)1-11/h2,8,14H,1,3,11-12H2 |
| InChIKey | BVFQKXBTTORQGD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |