C8H5Br2NO — CID 133062246
3-bromo-5-(bromomethyl)furo[2,3-b]pyridine (PubChem CID 133062246) has the molecular formula C8H5Br2NO and a molecular weight of 290.94 g/mol. Its IUPAC name is 3-bromo-5-(bromomethyl)furo[2,3-b]pyridine.
| Compound Name | 3-bromo-5-(bromomethyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 133062246 |
| Molecular Formula | C8H5Br2NO |
| Molecular Weight | 290.94 g/mol |
| Exact Mass | 288.87 |
| IUPAC Name | 3-bromo-5-(bromomethyl)furo[2,3-b]pyridine |
| SMILES | BrCc1cnc2occ(Br)c2c1 |
| InChI | InChI=1S/C8H5Br2NO/c9-2-5-1-6-7(10)4-12-8(6)11-3-5/h1,3-4H,2H2 |
| InChIKey | OQZNHZXPJQPEJR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.94 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|