C15H15NO3S — CID 103985961
2-(oxolan-3-ylmethyl)-4-phenyl-1,3-thiazole-5-carboxylic acid (PubChem CID 103985961) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)-4-phenyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(oxolan-3-ylmethyl)-4-phenyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103985961 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)-4-phenyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(CC2CCOC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C15H15NO3S/c17-15(18)14-13(11-4-2-1-3-5-11)16-12(20-14)8-10-6-7-19-9-10/h1-5,10H,6-9H2,(H,17,18) |
| InChIKey | PJNADRYCHYFYMV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |