C10H6INO2S — CID 58016057
2-iodo-4-phenyl-1,3-thiazole-5-carboxylic acid (PubChem CID 58016057) has the molecular formula C10H6INO2S and a molecular weight of 331.13 g/mol. Its IUPAC name is 2-iodo-4-phenyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-iodo-4-phenyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 58016057 |
| Molecular Formula | C10H6INO2S |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | 2-iodo-4-phenyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(I)nc1-c1ccccc1 |
| InChI | InChI=1S/C10H6INO2S/c11-10-12-7(8(15-10)9(13)14)6-4-2-1-3-5-6/h1-5H,(H,13,14) |
| InChIKey | NMAAXIBMDGAPGM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|