C25H17N3O2S — CID 118727567
2-(1,3-diphenylpyrazol-4-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid (PubChem CID 118727567) has the molecular formula C25H17N3O2S and a molecular weight of 423.50 g/mol. Its IUPAC name is 2-(1,3-diphenylpyrazol-4-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(1,3-diphenylpyrazol-4-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 118727567 |
| Molecular Formula | C25H17N3O2S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-(1,3-diphenylpyrazol-4-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2cn(-c3ccccc3)nc2-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H17N3O2S/c29-25(30)23-22(18-12-6-2-7-13-18)26-24(31-23)20-16-28(19-14-8-3-9-15-19)27-21(20)17-10-4-1-5-11-17/h1-16H,(H,29,30) |
| InChIKey | DMWKGHAOYSKCGP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |