C15H9ClN2O2S — CID 94970678
2-(2-chlorophenyl)-4-pyridin-3-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 94970678) has the molecular formula C15H9ClN2O2S and a molecular weight of 316.77 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-pyridin-3-yl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-chlorophenyl)-4-pyridin-3-yl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 94970678 |
| Molecular Formula | C15H9ClN2O2S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-(2-chlorophenyl)-4-pyridin-3-yl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccccc2Cl)nc1-c1cccnc1 |
| InChI | InChI=1S/C15H9ClN2O2S/c16-11-6-2-1-5-10(11)14-18-12(13(21-14)15(19)20)9-4-3-7-17-8-9/h1-8H,(H,19,20) |
| InChIKey | OPOJQQALSQQQTQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |