2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid

C15H11N3O2S — CID 82069424

IUPAC2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid
SMILESO=C(O)Cc1sc(-c2cccnc2)nc1-c1cccnc1
InChIInChI=1S/C15H11N3O2S/c19-13(20)7-12-14(10-3-1-5-16-8-10)18-15(21-12)11-4-2-6-17-9-11/h1-6,8-9H,7H2,(H,19,20)
InChIKeyNFSXQLHQZFUVIC-UHFFFAOYSA-N
MW297.34 g/mol
LogP2.89
Rot. Bonds4

About 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid

2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid (PubChem CID 82069424) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid
PubChem CID82069424
Molecular FormulaC15H11N3O2S
Molecular Weight297.34 g/mol
Exact Mass297.06
IUPAC Name2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid
SMILESO=C(O)Cc1sc(-c2cccnc2)nc1-c1cccnc1
InChIInChI=1S/C15H11N3O2S/c19-13(20)7-12-14(10-3-1-5-16-8-10)18-15(21-12)11-4-2-6-17-9-11/h1-6,8-9H,7H2,(H,19,20)
InChIKeyNFSXQLHQZFUVIC-UHFFFAOYSA-N
XLogP2.89
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.34
LogP ≤ 52.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid?
The IUPAC name of 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid (CID 82069424) is 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid is O=C(O)Cc1sc(-c2cccnc2)nc1-c1cccnc1.
What is the InChIKey of 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid?
The InChIKey is NFSXQLHQZFUVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O2S/c19-13(20)7-12-14(10-3-1-5-16-8-10)18-15(21-12)11-4-2-6-17-9-11/h1-6,8-9H,7H2,(H,19,20).
What are the key properties of 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid?
2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid has a molecular weight of 297.34 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid is sourced from PubChem (CID 82069424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).