C15H11N3O2S — CID 82069424
2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid (PubChem CID 82069424) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid.
| Compound Name | 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 82069424 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-(2,4-dipyridin-3-yl-1,3-thiazol-5-yl)acetic acid |
| SMILES | O=C(O)Cc1sc(-c2cccnc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C15H11N3O2S/c19-13(20)7-12-14(10-3-1-5-16-8-10)18-15(21-12)11-4-2-6-17-9-11/h1-6,8-9H,7H2,(H,19,20) |
| InChIKey | NFSXQLHQZFUVIC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |