C21H17N3S — CID 53494006
N-[(4-phenyl-2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 53494006) has the molecular formula C21H17N3S and a molecular weight of 343.46 g/mol. Its IUPAC name is N-[(4-phenyl-2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | N-[(4-phenyl-2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 53494006 |
| Molecular Formula | C21H17N3S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[(4-phenyl-2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | c1ccc(NCc2sc(-c3cccnc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3S/c1-3-8-16(9-4-1)20-19(15-23-18-11-5-2-6-12-18)25-21(24-20)17-10-7-13-22-14-17/h1-14,23H,15H2 |
| InChIKey | GYRHBIJLJATNHA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |