C15H22N2S — CID 178171856
ethane;5-ethyl-4-propyl-2-pyridin-3-yl-1,3-thiazole (PubChem CID 178171856) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is ethane;5-ethyl-4-propyl-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | ethane;5-ethyl-4-propyl-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 178171856 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | ethane;5-ethyl-4-propyl-2-pyridin-3-yl-1,3-thiazole |
| SMILES | CC.CCCc1nc(-c2cccnc2)sc1CC |
| InChI | InChI=1S/C13H16N2S.C2H6/c1-3-6-11-12(4-2)16-13(15-11)10-7-5-8-14-9-10;1-2/h5,7-9H,3-4,6H2,1-2H3;1-2H3 |
| InChIKey | NAYACAOWDPEKTH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |