C11H13N3OS — CID 143129382
O-[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethyl]hydroxylamine (PubChem CID 143129382) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is O-[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 143129382 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | O-[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethyl]hydroxylamine |
| SMILES | Cc1nc(-c2cccnc2)sc1CCON |
| InChI | InChI=1S/C11H13N3OS/c1-8-10(4-6-15-12)16-11(14-8)9-3-2-5-13-7-9/h2-3,5,7H,4,6,12H2,1H3 |
| InChIKey | USOPEWQZYHKYCL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|