3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid

C15H17NO2S — CID 82431422

IUPAC3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid
SMILESCCCc1nc(-c2ccccc2)sc1CCC(=O)O
InChIInChI=1S/C15H17NO2S/c1-2-6-12-13(9-10-14(17)18)19-15(16-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3,(H,17,18)
InChIKeyACLMCNQDCHWRPL-UHFFFAOYSA-N
MW275.37 g/mol
LogP3.78
Rot. Bonds6

About 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid

3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid (PubChem CID 82431422) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid
PubChem CID82431422
Molecular FormulaC15H17NO2S
Molecular Weight275.37 g/mol
Exact Mass275.10
IUPAC Name3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid
SMILESCCCc1nc(-c2ccccc2)sc1CCC(=O)O
InChIInChI=1S/C15H17NO2S/c1-2-6-12-13(9-10-14(17)18)19-15(16-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3,(H,17,18)
InChIKeyACLMCNQDCHWRPL-UHFFFAOYSA-N
XLogP3.78
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.37
LogP ≤ 53.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid?
The IUPAC name of 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid (CID 82431422) is 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid.
What is the SMILES notation for 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid?
The canonical SMILES for 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid is CCCc1nc(-c2ccccc2)sc1CCC(=O)O.
What is the InChIKey of 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid?
The InChIKey is ACLMCNQDCHWRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2S/c1-2-6-12-13(9-10-14(17)18)19-15(16-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3,(H,17,18).
What are the key properties of 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid?
3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid has a molecular weight of 275.37 g/mol, XLogP of 3.78, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenyl-4-propyl-1,3-thiazol-5-yl)propanoic acid is sourced from PubChem (CID 82431422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).