C14H23NO2S — CID 82432457
3-(2-pentan-3-yl-4-propyl-1,3-thiazol-5-yl)propanoic acid (PubChem CID 82432457) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 3-(2-pentan-3-yl-4-propyl-1,3-thiazol-5-yl)propanoic acid.
| Compound Name | 3-(2-pentan-3-yl-4-propyl-1,3-thiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 82432457 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-(2-pentan-3-yl-4-propyl-1,3-thiazol-5-yl)propanoic acid |
| SMILES | CCCc1nc(C(CC)CC)sc1CCC(=O)O |
| InChI | InChI=1S/C14H23NO2S/c1-4-7-11-12(8-9-13(16)17)18-14(15-11)10(5-2)6-3/h10H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | VFLWTBQTIHPHEC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |