3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid

C16H19NO2S — CID 82431158

IUPAC3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid
SMILESCCc1nc(CCc2ccccc2)sc1CCC(=O)O
InChIInChI=1S/C16H19NO2S/c1-2-13-14(9-11-16(18)19)20-15(17-13)10-8-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,18,19)
InChIKeyWZJKXCDODXUZES-UHFFFAOYSA-N
MW289.40 g/mol
LogP3.51
Rot. Bonds7

About 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid

3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 82431158) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid
PubChem CID82431158
Molecular FormulaC16H19NO2S
Molecular Weight289.40 g/mol
Exact Mass289.11
IUPAC Name3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid
SMILESCCc1nc(CCc2ccccc2)sc1CCC(=O)O
InChIInChI=1S/C16H19NO2S/c1-2-13-14(9-11-16(18)19)20-15(17-13)10-8-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,18,19)
InChIKeyWZJKXCDODXUZES-UHFFFAOYSA-N
XLogP3.51
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.40
LogP ≤ 53.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid?
The IUPAC name of 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid (CID 82431158) is 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid?
The canonical SMILES for 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid is CCc1nc(CCc2ccccc2)sc1CCC(=O)O.
What is the InChIKey of 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid?
The InChIKey is WZJKXCDODXUZES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c1-2-13-14(9-11-16(18)19)20-15(17-13)10-8-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,18,19).
What are the key properties of 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid?
3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid has a molecular weight of 289.40 g/mol, XLogP of 3.51, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-ethyl-2-(2-phenylethyl)-1,3-thiazol-5-yl]propanoic acid is sourced from PubChem (CID 82431158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).