C16H5Cl6NO2S — CID 134617786
2,4-bis(3,4,5-trichlorophenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 134617786) has the molecular formula C16H5Cl6NO2S and a molecular weight of 488.01 g/mol. Its IUPAC name is 2,4-bis(3,4,5-trichlorophenyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2,4-bis(3,4,5-trichlorophenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 134617786 |
| Molecular Formula | C16H5Cl6NO2S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 484.82 |
| IUPAC Name | 2,4-bis(3,4,5-trichlorophenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2cc(Cl)c(Cl)c(Cl)c2)nc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H5Cl6NO2S/c17-7-1-5(2-8(18)11(7)21)13-14(16(24)25)26-15(23-13)6-3-9(19)12(22)10(20)4-6/h1-4H,(H,24,25) |
| InChIKey | HQWWJKOKKPPMRD-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|