C17H7Cl6NO2S — CID 134636605
methyl 2,4-bis(3,4,5-trichlorophenyl)-1,3-thiazole-5-carboxylate (PubChem CID 134636605) has the molecular formula C17H7Cl6NO2S and a molecular weight of 502.03 g/mol. Its IUPAC name is methyl 2,4-bis(3,4,5-trichlorophenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2,4-bis(3,4,5-trichlorophenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 134636605 |
| Molecular Formula | C17H7Cl6NO2S |
| Molecular Weight | 502.03 g/mol |
| Exact Mass | 498.83 |
| IUPAC Name | methyl 2,4-bis(3,4,5-trichlorophenyl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(-c2cc(Cl)c(Cl)c(Cl)c2)nc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H7Cl6NO2S/c1-26-17(25)15-14(6-2-8(18)12(22)9(19)3-6)24-16(27-15)7-4-10(20)13(23)11(21)5-7/h2-5H,1H3 |
| InChIKey | BTHIYKJJORDAGJ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.03 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|