C11H6ClNO4S — CID 118611364
4-(4-chlorophenyl)-1,3-thiazole-2,5-dicarboxylic acid (PubChem CID 118611364) has the molecular formula C11H6ClNO4S and a molecular weight of 283.69 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,3-thiazole-2,5-dicarboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-1,3-thiazole-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 118611364 |
| Molecular Formula | C11H6ClNO4S |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 4-(4-chlorophenyl)-1,3-thiazole-2,5-dicarboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccc(Cl)cc2)c(C(=O)O)s1 |
| InChI | InChI=1S/C11H6ClNO4S/c12-6-3-1-5(2-4-6)7-8(10(14)15)18-9(13-7)11(16)17/h1-4H,(H,14,15)(H,16,17) |
| InChIKey | VXIVUMHAJSWJJI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |