C17H11Cl2NO2S2 — CID 54436088
2-[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid (PubChem CID 54436088) has the molecular formula C17H11Cl2NO2S2 and a molecular weight of 396.32 g/mol. Its IUPAC name is 2-[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid.
| Compound Name | 2-[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid |
|---|---|
| PubChem CID | 54436088 |
| Molecular Formula | C17H11Cl2NO2S2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 2-[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid |
| SMILES | O=C(O)C(S)c1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H11Cl2NO2S2/c18-11-5-1-9(2-6-11)13-15(10-3-7-12(19)8-4-10)24-16(20-13)14(23)17(21)22/h1-8,14,23H,(H,21,22) |
| InChIKey | WKUPXDIDZUYSHD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|